| Name | Allyl Tribromophenyl Ether |
| Synonyms | ALLYL TRIBROMOPHENYL ETHER Allyl Tribromophenyl Ether TRIBROMOPHENYL ALLYL ETHER ALLYL 2,4,6-TRIBROMOPHENYL ETHER 2-allyloxy-1,3,5-tribromobenzene Allyl 2,4,6-tribromophenyl ether 2-Allyloxy-1,3,5-tribromobenzene 1,3,5-tribromo-2-(2-propenyloxy)-benzen Benzene,1,3,5-tribromo-2-(2-propenyloxy) 1,3,5-TribroMo-2-(2-propen-1-yloxy)-benzene 1,3,5-tribromo-2-(prop-2-en-1-yloxy)benzene |
| CAS | 3278-89-5 |
| EINECS | 221-913-2 |
| InChI | InChI=1/C9H7Br3O/c1-2-3-13-9-7(11)4-6(10)5-8(9)12/h2,4-5H,1,3H2 |
| Molecular Formula | C9H7Br3O |
| Molar Mass | 370.86 |
| Density | 1.950±0.06 g/cm3(Predicted) |
| Melting Point | 74-76 °C (lit.) |
| Boling Point | 339.5±37.0 °C(Predicted) |
| Flash Point | 138°C |
| Vapor Presure | 0.00018mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.599 |
| Use | For polystyrene foam, when combined with HBCD, is an effective synergist |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used in polystyrene foam, when used in combination with hexabromocyclododecane, it is an effective synergic agent |